C13H19O2PS — CID 13356978
(1S,2R)-6,7-dimethoxy-1,2-dimethyl-2-sulfanylidene-3,4-dihydro-1H-isophosphinoline (PubChem CID 13356978) has the molecular formula C13H19O2PS and a molecular weight of 270.33 g/mol. Its IUPAC name is (1S,2R)-6,7-dimethoxy-1,2-dimethyl-2-sulfanylidene-3,4-dihydro-1H-isophosphinoline.
| Compound Name | (1S,2R)-6,7-dimethoxy-1,2-dimethyl-2-sulfanylidene-3,4-dihydro-1H-isophosphinoline |
|---|---|
| PubChem CID | 13356978 |
| Molecular Formula | C13H19O2PS |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (1S,2R)-6,7-dimethoxy-1,2-dimethyl-2-sulfanylidene-3,4-dihydro-1H-isophosphinoline |
| SMILES | COc1cc2c(cc1OC)[C@H](C)[P@](C)(=S)CC2 |
| InChI | InChI=1S/C13H19O2PS/c1-9-11-8-13(15-3)12(14-2)7-10(11)5-6-16(9,4)17/h7-9H,5-6H2,1-4H3/t9-,16+/m0/s1 |
| InChIKey | ALYHBQKJSGWZCL-XXFAHNHDSA-N |
| XLogP | 3.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|