C15H23NO2 — CID 42056014
(1S)-1-tert-butyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 42056014) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (1S)-1-tert-butyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1S)-1-tert-butyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 42056014 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (1S)-1-tert-butyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)[C@H](C(C)(C)C)NCC2 |
| InChI | InChI=1S/C15H23NO2/c1-15(2,3)14-11-9-13(18-5)12(17-4)8-10(11)6-7-16-14/h8-9,14,16H,6-7H2,1-5H3/t14-/m1/s1 |
| InChIKey | FOAHVIKIRZCFDA-CQSZACIVSA-N |
| XLogP | 2.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |