C48H62N2O12 — CID 70523801
bis[2-(dimethylamino)-2-phenyl-1-[(3,4,5-trimethoxyphenyl)methoxy]butyl] (Z)-but-2-enedioate (PubChem CID 70523801) has the molecular formula C48H62N2O12 and a molecular weight of 859.03 g/mol. Its IUPAC name is bis[2-(dimethylamino)-2-phenyl-1-[(3,4,5-trimethoxyphenyl)methoxy]butyl] (Z)-but-2-enedioate.
| Compound Name | bis[2-(dimethylamino)-2-phenyl-1-[(3,4,5-trimethoxyphenyl)methoxy]butyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 70523801 |
| Molecular Formula | C48H62N2O12 |
| Molecular Weight | 859.03 g/mol |
| Exact Mass | 858.43 |
| IUPAC Name | bis[2-(dimethylamino)-2-phenyl-1-[(3,4,5-trimethoxyphenyl)methoxy]butyl] (Z)-but-2-enedioate |
| SMILES | CCC(c1ccccc1)(C(OCc1cc(OC)c(OC)c(OC)c1)OC(=O)/C=C\C(=O)OC(OCc1cc(OC)c(OC)c(OC)c1)C(CC)(c1ccccc1)N(C)C)N(C)C |
| InChI | InChI=1S/C48H62N2O12/c1-13-47(49(3)4,35-21-17-15-18-22-35)45(59-31-33-27-37(53-7)43(57-11)38(28-33)54-8)61-41(51)25-26-42(52)62-46(48(14-2,50(5)6)36-23-19-16-20-24-36)60-32-34-29-39(55-9)44(58-12)40(30-34)56-10/h15-30,45-46H,13-14,31-32H2,1-12H3/b26-25- |
| InChIKey | XVCJVZCSHNPWNE-QPLCGJKRSA-N |
| XLogP | 7.50 |
| TPSA | 132.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.03 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|