C21H27NO4 — CID 110356184
4-methyl-4-phenyl-N-(3,4,5-trimethoxyphenyl)pentanamide (PubChem CID 110356184) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 4-methyl-4-phenyl-N-(3,4,5-trimethoxyphenyl)pentanamide.
| Compound Name | 4-methyl-4-phenyl-N-(3,4,5-trimethoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 110356184 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 4-methyl-4-phenyl-N-(3,4,5-trimethoxyphenyl)pentanamide |
| SMILES | COc1cc(NC(=O)CCC(C)(C)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H27NO4/c1-21(2,15-9-7-6-8-10-15)12-11-19(23)22-16-13-17(24-3)20(26-5)18(14-16)25-4/h6-10,13-14H,11-12H2,1-5H3,(H,22,23) |
| InChIKey | GENAUALSXBJQCI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |