C24H34O10 — CID 175639700
(2S,3S)-1,4-bis[(3,4,5-trimethoxyphenyl)methoxy]butane-2,3-diol (PubChem CID 175639700) has the molecular formula C24H34O10 and a molecular weight of 482.53 g/mol. Its IUPAC name is (2S,3S)-1,4-bis[(3,4,5-trimethoxyphenyl)methoxy]butane-2,3-diol.
| Compound Name | (2S,3S)-1,4-bis[(3,4,5-trimethoxyphenyl)methoxy]butane-2,3-diol |
|---|---|
| PubChem CID | 175639700 |
| Molecular Formula | C24H34O10 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (2S,3S)-1,4-bis[(3,4,5-trimethoxyphenyl)methoxy]butane-2,3-diol |
| SMILES | COc1cc(COC[C@H](O)[C@@H](O)COCc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H34O10/c1-27-19-7-15(8-20(28-2)23(19)31-5)11-33-13-17(25)18(26)14-34-12-16-9-21(29-3)24(32-6)22(10-16)30-4/h7-10,17-18,25-26H,11-14H2,1-6H3/t17-,18-/m0/s1 |
| InChIKey | ZQVAGUTYCQRDPF-ROUUACIJSA-N |
| XLogP | 2.19 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |