C14H22O8 — CID 91251641
(2R,3R,4R,5S)-6-[(4-hydroxy-3-methoxyphenyl)methoxy]hexane-1,2,3,4,5-pentol (PubChem CID 91251641) has the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[(4-hydroxy-3-methoxyphenyl)methoxy]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[(4-hydroxy-3-methoxyphenyl)methoxy]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 91251641 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (2R,3R,4R,5S)-6-[(4-hydroxy-3-methoxyphenyl)methoxy]hexane-1,2,3,4,5-pentol |
| SMILES | COc1cc(COC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)ccc1O |
| InChI | InChI=1S/C14H22O8/c1-21-12-4-8(2-3-9(12)16)6-22-7-11(18)14(20)13(19)10(17)5-15/h2-4,10-11,13-20H,5-7H2,1H3/t10-,11+,13-,14-/m1/s1 |
| InChIKey | JTHBGKQOWKSODA-ZMJPVWNMSA-N |
| XLogP | -1.65 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |