C19H17NO6 — CID 67984682
methyl 7-methoxy-1,3-dioxo-2-phenylmethoxy-4H-isoquinoline-4-carboxylate (PubChem CID 67984682) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is methyl 7-methoxy-1,3-dioxo-2-phenylmethoxy-4H-isoquinoline-4-carboxylate.
| Compound Name | methyl 7-methoxy-1,3-dioxo-2-phenylmethoxy-4H-isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 67984682 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | methyl 7-methoxy-1,3-dioxo-2-phenylmethoxy-4H-isoquinoline-4-carboxylate |
| SMILES | COC(=O)C1C(=O)N(OCc2ccccc2)C(=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C19H17NO6/c1-24-13-8-9-14-15(10-13)17(21)20(18(22)16(14)19(23)25-2)26-11-12-6-4-3-5-7-12/h3-10,16H,11H2,1-2H3 |
| InChIKey | CVWXPWACAIIJBY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|