C31H35N3O5 — CID 137389819
(3R,4R)-2-[(2R)-2-aminocyclohexyl]-3-(2,4-dimethoxyphenyl)-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 137389819) has the molecular formula C31H35N3O5 and a molecular weight of 529.64 g/mol. Its IUPAC name is (3R,4R)-2-[(2R)-2-aminocyclohexyl]-3-(2,4-dimethoxyphenyl)-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-2-[(2R)-2-aminocyclohexyl]-3-(2,4-dimethoxyphenyl)-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 137389819 |
| Molecular Formula | C31H35N3O5 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | (3R,4R)-2-[(2R)-2-aminocyclohexyl]-3-(2,4-dimethoxyphenyl)-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | COc1ccc([C@H]2[C@H](C(=O)NOCc3ccccc3)c3ccccc3C(=O)N2C2CCCC[C@H]2N)c(OC)c1 |
| InChI | InChI=1S/C31H35N3O5/c1-37-21-16-17-24(27(18-21)38-2)29-28(30(35)33-39-19-20-10-4-3-5-11-20)22-12-6-7-13-23(22)31(36)34(29)26-15-9-8-14-25(26)32/h3-7,10-13,16-18,25-26,28-29H,8-9,14-15,19,32H2,1-2H3,(H,33,35)/t25-,26?,28-,29+/m1/s1 |
| InChIKey | UELBPCYTUIGZHE-NLJJLZQHSA-N |
| XLogP | 4.50 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|