C33H28Cl2N2O4 — CID 59478647
3-(2,4-dichlorophenyl)-2-(3-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478647) has the molecular formula C33H28Cl2N2O4 and a molecular weight of 587.50 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2-(3-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | 3-(2,4-dichlorophenyl)-2-(3-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478647 |
| Molecular Formula | C33H28Cl2N2O4 |
| Molecular Weight | 587.50 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2-(3-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | O=C(NOCc1ccccc1)C1c2ccccc2C(=O)N(C2Cc3ccccc3CC2O)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C33H28Cl2N2O4/c34-23-14-15-26(27(35)18-23)31-30(32(39)36-41-19-20-8-2-1-3-9-20)24-12-6-7-13-25(24)33(40)37(31)28-16-21-10-4-5-11-22(21)17-29(28)38/h1-15,18,28-31,38H,16-17,19H2,(H,36,39) |
| InChIKey | DPZJMEYCKGJODC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.50 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|