C27H23Cl3N2O4 — CID 89030039
N-[(4-chlorophenyl)methoxy]-3-(2,4-dichlorophenyl)-1-oxo-2-(oxolan-3-yl)-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 89030039) has the molecular formula C27H23Cl3N2O4 and a molecular weight of 545.85 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methoxy]-3-(2,4-dichlorophenyl)-1-oxo-2-(oxolan-3-yl)-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methoxy]-3-(2,4-dichlorophenyl)-1-oxo-2-(oxolan-3-yl)-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 89030039 |
| Molecular Formula | C27H23Cl3N2O4 |
| Molecular Weight | 545.85 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | N-[(4-chlorophenyl)methoxy]-3-(2,4-dichlorophenyl)-1-oxo-2-(oxolan-3-yl)-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | O=C(NOCc1ccc(Cl)cc1)C1c2ccccc2C(=O)N(C2CCOC2)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H23Cl3N2O4/c28-17-7-5-16(6-8-17)14-36-31-26(33)24-20-3-1-2-4-21(20)27(34)32(19-11-12-35-15-19)25(24)22-10-9-18(29)13-23(22)30/h1-10,13,19,24-25H,11-12,14-15H2,(H,31,33) |
| InChIKey | KCKJFIAPCPKDLV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.85 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|