C29H27Cl2N3O4 — CID 89098244
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-nitrosocyclohexyl]-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 89098244) has the molecular formula C29H27Cl2N3O4 and a molecular weight of 552.46 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-nitrosocyclohexyl]-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-nitrosocyclohexyl]-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 89098244 |
| Molecular Formula | C29H27Cl2N3O4 |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-nitrosocyclohexyl]-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | O=N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2ccccc2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H27Cl2N3O4/c30-19-14-15-22(23(31)16-19)27-26(28(35)33-38-17-18-8-2-1-3-9-18)20-10-4-5-11-21(20)29(36)34(27)25-13-7-6-12-24(25)32-37/h1-5,8-11,14-16,24-27H,6-7,12-13,17H2,(H,33,35)/t24-,25-,26+,27-/m0/s1 |
| InChIKey | OPJCONOLSLVROO-NFGXINMFSA-N |
| XLogP | 6.60 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|