C32H35Cl2N3O5S — CID 118587944
(3R,4R)-3-(2,4-dichlorophenyl)-N-[[3-(1,3-dihydroxypropan-2-yl)phenyl]methoxy]-1-oxo-2-[(2S)-2-(sulfanylamino)cyclohexyl]-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 118587944) has the molecular formula C32H35Cl2N3O5S and a molecular weight of 644.62 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-N-[[3-(1,3-dihydroxypropan-2-yl)phenyl]methoxy]-1-oxo-2-[(2S)-2-(sulfanylamino)cyclohexyl]-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-N-[[3-(1,3-dihydroxypropan-2-yl)phenyl]methoxy]-1-oxo-2-[(2S)-2-(sulfanylamino)cyclohexyl]-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 118587944 |
| Molecular Formula | C32H35Cl2N3O5S |
| Molecular Weight | 644.62 g/mol |
| Exact Mass | 643.17 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-N-[[3-(1,3-dihydroxypropan-2-yl)phenyl]methoxy]-1-oxo-2-[(2S)-2-(sulfanylamino)cyclohexyl]-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | O=C(NOCc1cccc(C(CO)CO)c1)[C@@H]1c2ccccc2C(=O)N(C2CCCC[C@@H]2NS)[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H35Cl2N3O5S/c33-22-12-13-25(26(34)15-22)30-29(31(40)35-42-18-19-6-5-7-20(14-19)21(16-38)17-39)23-8-1-2-9-24(23)32(41)37(30)28-11-4-3-10-27(28)36-43/h1-2,5-9,12-15,21,27-30,36,38-39,43H,3-4,10-11,16-18H2,(H,35,40)/t27-,28?,29+,30-/m0/s1 |
| InChIKey | ACDDKRZUZLFGFZ-LBIXZHBDSA-N |
| XLogP | 5.34 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|