C31H33Cl2N3O7S2 — CID 59479148
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-N-[(4-methylsulfonylphenyl)methoxy]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59479148) has the molecular formula C31H33Cl2N3O7S2 and a molecular weight of 694.66 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-N-[(4-methylsulfonylphenyl)methoxy]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-N-[(4-methylsulfonylphenyl)methoxy]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59479148 |
| Molecular Formula | C31H33Cl2N3O7S2 |
| Molecular Weight | 694.66 g/mol |
| Exact Mass | 693.11 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-N-[(4-methylsulfonylphenyl)methoxy]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2ccc(S(C)(=O)=O)cc2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H33Cl2N3O7S2/c1-44(39,40)21-14-11-19(12-15-21)18-43-34-30(37)28-22-7-3-4-8-23(22)31(38)36(29(28)24-16-13-20(32)17-25(24)33)27-10-6-5-9-26(27)35-45(2,41)42/h3-4,7-8,11-17,26-29,35H,5-6,9-10,18H2,1-2H3,(H,34,37)/t26-,27-,28+,29-/m0/s1 |
| InChIKey | HPSYBJBPYWDIAH-FKWFRFQNSA-N |
| XLogP | 4.79 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|