C25H29Cl2N3O5S — CID 118588101
(3R,4R)-3-(2,4-dichlorophenyl)-N-ethoxy-2-[(2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 118588101) has the molecular formula C25H29Cl2N3O5S and a molecular weight of 554.50 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-N-ethoxy-2-[(2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-N-ethoxy-2-[(2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 118588101 |
| Molecular Formula | C25H29Cl2N3O5S |
| Molecular Weight | 554.50 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-N-ethoxy-2-[(2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CCONC(=O)[C@@H]1c2ccccc2C(=O)N(C2CCCC[C@@H]2NS(C)(=O)=O)[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H29Cl2N3O5S/c1-3-35-28-24(31)22-16-8-4-5-9-17(16)25(32)30(23(22)18-13-12-15(26)14-19(18)27)21-11-7-6-10-20(21)29-36(2,33)34/h4-5,8-9,12-14,20-23,29H,3,6-7,10-11H2,1-2H3,(H,28,31)/t20-,21?,22+,23-/m0/s1 |
| InChIKey | VEPVZCVQWXWVGC-FXHBAXTJSA-N |
| XLogP | 4.20 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|