C28H28Cl2N4O8S — CID 59478572
2-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 59478572) has the molecular formula C28H28Cl2N4O8S and a molecular weight of 651.53 g/mol. Its IUPAC name is 2-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 59478572 |
| Molecular Formula | C28H28Cl2N4O8S |
| Molecular Weight | 651.53 g/mol |
| Exact Mass | 650.10 |
| IUPAC Name | 2-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | CS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2nc(C(=O)O)co2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H28Cl2N4O8S/c1-43(39,40)33-20-8-4-5-9-22(20)34-25(18-11-10-15(29)12-19(18)30)24(16-6-2-3-7-17(16)27(34)36)26(35)32-42-14-23-31-21(13-41-23)28(37)38/h2-3,6-7,10-13,20,22,24-25,33H,4-5,8-9,14H2,1H3,(H,32,35)(H,37,38)/t20-,22-,24+,25-/m0/s1 |
| InChIKey | DICGZHIVMPTWBO-INWJIATQSA-N |
| XLogP | 4.07 |
| TPSA | 168.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|