C29H29Cl2N3O6S2 — CID 59478607
5-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]methyl]thiophene-2-carboxylic acid (PubChem CID 59478607) has the molecular formula C29H29Cl2N3O6S2 and a molecular weight of 650.61 g/mol. Its IUPAC name is 5-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59478607 |
| Molecular Formula | C29H29Cl2N3O6S2 |
| Molecular Weight | 650.61 g/mol |
| Exact Mass | 649.09 |
| IUPAC Name | 5-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]methyl]thiophene-2-carboxylic acid |
| SMILES | CS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NCc2ccc(C(=O)O)s2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H29Cl2N3O6S2/c1-42(39,40)33-22-8-4-5-9-23(22)34-26(20-12-10-16(30)14-21(20)31)25(18-6-2-3-7-19(18)28(34)36)27(35)32-15-17-11-13-24(41-17)29(37)38/h2-3,6-7,10-14,22-23,25-26,33H,4-5,8-9,15H2,1H3,(H,32,35)(H,37,38)/t22-,23-,25+,26-/m0/s1 |
| InChIKey | DXJIROQVHKDRMR-LJCOXQHRSA-N |
| XLogP | 5.21 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |