C27H28Cl2N4O4S2 — CID 118421505
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 118421505) has the molecular formula C27H28Cl2N4O4S2 and a molecular weight of 607.59 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 118421505 |
| Molecular Formula | C27H28Cl2N4O4S2 |
| Molecular Weight | 607.59 g/mol |
| Exact Mass | 606.09 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NCc2nccs2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H28Cl2N4O4S2/c1-39(36,37)32-21-8-4-5-9-22(21)33-25(19-11-10-16(28)14-20(19)29)24(17-6-2-3-7-18(17)27(33)35)26(34)31-15-23-30-12-13-38-23/h2-3,6-7,10-14,21-22,24-25,32H,4-5,8-9,15H2,1H3,(H,31,34)/t21-,22-,24+,25-/m0/s1 |
| InChIKey | PIAFSWWQWTXKBR-HFOXQMJASA-N |
| XLogP | 4.91 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |