C29H30Cl2N4O5S — CID 59478207
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-N-[(1-oxidopyridin-1-ium-4-yl)methyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478207) has the molecular formula C29H30Cl2N4O5S and a molecular weight of 617.56 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-N-[(1-oxidopyridin-1-ium-4-yl)methyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-N-[(1-oxidopyridin-1-ium-4-yl)methyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478207 |
| Molecular Formula | C29H30Cl2N4O5S |
| Molecular Weight | 617.56 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-N-[(1-oxidopyridin-1-ium-4-yl)methyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NCc2cc[n+]([O-])cc2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H30Cl2N4O5S/c1-41(39,40)33-24-8-4-5-9-25(24)35-27(22-11-10-19(30)16-23(22)31)26(20-6-2-3-7-21(20)29(35)37)28(36)32-17-18-12-14-34(38)15-13-18/h2-3,6-7,10-16,24-27,33H,4-5,8-9,17H2,1H3,(H,32,36)/t24-,25-,26+,27-/m0/s1 |
| InChIKey | MQJWVLYPQSFXRT-NFGXINMFSA-N |
| XLogP | 4.08 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|