C28H29Cl2N5O4S — CID 59478252
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-(pyridazin-4-ylmethyl)-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478252) has the molecular formula C28H29Cl2N5O4S and a molecular weight of 602.54 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-(pyridazin-4-ylmethyl)-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-(pyridazin-4-ylmethyl)-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478252 |
| Molecular Formula | C28H29Cl2N5O4S |
| Molecular Weight | 602.54 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-(pyridazin-4-ylmethyl)-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NCc2ccnnc2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H29Cl2N5O4S/c1-40(38,39)34-23-8-4-5-9-24(23)35-26(21-11-10-18(29)14-22(21)30)25(19-6-2-3-7-20(19)28(35)37)27(36)31-15-17-12-13-32-33-16-17/h2-3,6-7,10-14,16,23-26,34H,4-5,8-9,15H2,1H3,(H,31,36)/t23-,24-,25+,26-/m0/s1 |
| InChIKey | KTBRANPVFBYJDW-SSUZURRFSA-N |
| XLogP | 4.24 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |