C29H33Cl2N5O6S — CID 70850037
2-[2-[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]-3,4-dihydropyrazole-5-carboxylic acid (PubChem CID 70850037) has the molecular formula C29H33Cl2N5O6S and a molecular weight of 650.59 g/mol. Its IUPAC name is 2-[2-[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]-3,4-dihydropyrazole-5-carboxylic acid.
| Compound Name | 2-[2-[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]-3,4-dihydropyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 70850037 |
| Molecular Formula | C29H33Cl2N5O6S |
| Molecular Weight | 650.59 g/mol |
| Exact Mass | 649.15 |
| IUPAC Name | 2-[2-[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]ethyl]-3,4-dihydropyrazole-5-carboxylic acid |
| SMILES | CS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NCCN2CCC(C(=O)O)=N2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H33Cl2N5O6S/c1-43(41,42)34-22-8-4-5-9-24(22)36-26(20-11-10-17(30)16-21(20)31)25(18-6-2-3-7-19(18)28(36)38)27(37)32-13-15-35-14-12-23(33-35)29(39)40/h2-3,6-7,10-11,16,22,24-26,34H,4-5,8-9,12-15H2,1H3,(H,32,37)(H,39,40)/t22-,24-,25+,26-/m0/s1 |
| InChIKey | NWBJIZOLTAENMS-MNPUUQGPSA-N |
| XLogP | 3.40 |
| TPSA | 148.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |