C31H33Cl2N5O6S — CID 118358372
(3R,4R)-N-[(6-acetamido-2-pyridinyl)methoxy]-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 118358372) has the molecular formula C31H33Cl2N5O6S and a molecular weight of 674.61 g/mol. Its IUPAC name is (3R,4R)-N-[(6-acetamido-2-pyridinyl)methoxy]-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-N-[(6-acetamido-2-pyridinyl)methoxy]-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 118358372 |
| Molecular Formula | C31H33Cl2N5O6S |
| Molecular Weight | 674.61 g/mol |
| Exact Mass | 673.15 |
| IUPAC Name | (3R,4R)-N-[(6-acetamido-2-pyridinyl)methoxy]-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CC(=O)Nc1cccc(CONC(=O)[C@@H]2c3ccccc3C(=O)N([C@H]3CCCC[C@@H]3NS(C)(=O)=O)[C@H]2c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C31H33Cl2N5O6S/c1-18(39)34-27-13-7-8-20(35-27)17-44-36-30(40)28-21-9-3-4-10-22(21)31(41)38(29(28)23-15-14-19(32)16-24(23)33)26-12-6-5-11-25(26)37-45(2,42)43/h3-4,7-10,13-16,25-26,28-29,37H,5-6,11-12,17H2,1-2H3,(H,36,40)(H,34,35,39)/t25-,26-,28+,29-/m0/s1 |
| InChIKey | FZDFVLDUOSUEHZ-KGKLHAENSA-N |
| XLogP | 4.74 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|