C32H36Cl2N4O4S — CID 130193284
(3R,4R)-N-[1-[4-(aminomethyl)phenyl]ethyl]-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 130193284) has the molecular formula C32H36Cl2N4O4S and a molecular weight of 643.64 g/mol. Its IUPAC name is (3R,4R)-N-[1-[4-(aminomethyl)phenyl]ethyl]-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-N-[1-[4-(aminomethyl)phenyl]ethyl]-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 130193284 |
| Molecular Formula | C32H36Cl2N4O4S |
| Molecular Weight | 643.64 g/mol |
| Exact Mass | 642.18 |
| IUPAC Name | (3R,4R)-N-[1-[4-(aminomethyl)phenyl]ethyl]-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CC(NC(=O)[C@@H]1c2ccccc2C(=O)N([C@H]2CCCC[C@@H]2NS(C)(=O)=O)[C@H]1c1ccc(Cl)cc1Cl)c1ccc(CN)cc1 |
| InChI | InChI=1S/C32H36Cl2N4O4S/c1-19(21-13-11-20(18-35)12-14-21)36-31(39)29-23-7-3-4-8-24(23)32(40)38(30(29)25-16-15-22(33)17-26(25)34)28-10-6-5-9-27(28)37-43(2,41)42/h3-4,7-8,11-17,19,27-30,37H,5-6,9-10,18,35H2,1-2H3,(H,36,39)/t19?,27-,28-,29+,30-/m0/s1 |
| InChIKey | IVKWXOBMOAVCOV-VTVMLYNNSA-N |
| XLogP | 5.47 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |