C25H29Cl2N5O6S — CID 59479117
(3R,4R)-3-(2,4-dichlorophenyl)-N-(2-hydrazinyl-2-oxoethoxy)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59479117) has the molecular formula C25H29Cl2N5O6S and a molecular weight of 598.51 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-N-(2-hydrazinyl-2-oxoethoxy)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-N-(2-hydrazinyl-2-oxoethoxy)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59479117 |
| Molecular Formula | C25H29Cl2N5O6S |
| Molecular Weight | 598.51 g/mol |
| Exact Mass | 597.12 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-N-(2-hydrazinyl-2-oxoethoxy)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCC(=O)NN)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H29Cl2N5O6S/c1-39(36,37)31-19-8-4-5-9-20(19)32-23(17-11-10-14(26)12-18(17)27)22(24(34)30-38-13-21(33)29-28)15-6-2-3-7-16(15)25(32)35/h2-3,6-7,10-12,19-20,22-23,31H,4-5,8-9,13,28H2,1H3,(H,29,33)(H,30,34)/t19-,20-,22+,23-/m0/s1 |
| InChIKey | PGDBFOMZDXGLOG-RLBLXZPPSA-N |
| XLogP | 2.17 |
| TPSA | 159.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|