C37H36Cl2N4O7S — CID 59478374
[2-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-4-pyridinyl]methyl benzoate (PubChem CID 59478374) has the molecular formula C37H36Cl2N4O7S and a molecular weight of 751.69 g/mol. Its IUPAC name is [2-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-4-pyridinyl]methyl benzoate.
| Compound Name | [2-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-4-pyridinyl]methyl benzoate |
|---|---|
| PubChem CID | 59478374 |
| Molecular Formula | C37H36Cl2N4O7S |
| Molecular Weight | 751.69 g/mol |
| Exact Mass | 750.17 |
| IUPAC Name | [2-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-4-pyridinyl]methyl benzoate |
| SMILES | CS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2cc(COC(=O)c3ccccc3)ccn2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C37H36Cl2N4O7S/c1-51(47,48)42-31-13-7-8-14-32(31)43-34(29-16-15-25(38)20-30(29)39)33(27-11-5-6-12-28(27)36(43)45)35(44)41-50-22-26-19-23(17-18-40-26)21-49-37(46)24-9-3-2-4-10-24/h2-6,9-12,15-20,31-34,42H,7-8,13-14,21-22H2,1H3,(H,41,44)/t31-,32-,33+,34-/m0/s1 |
| InChIKey | GGIZISPZKAYMBR-HVRNLMOBSA-N |
| XLogP | 6.13 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.69 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|