C29H30Cl2N4O6S — CID 59478674
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-[(6-oxo-1H-pyridin-2-yl)methoxy]-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478674) has the molecular formula C29H30Cl2N4O6S and a molecular weight of 633.55 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-[(6-oxo-1H-pyridin-2-yl)methoxy]-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-[(6-oxo-1H-pyridin-2-yl)methoxy]-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478674 |
| Molecular Formula | C29H30Cl2N4O6S |
| Molecular Weight | 633.55 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-[(6-oxo-1H-pyridin-2-yl)methoxy]-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2cccc(=O)[nH]2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H30Cl2N4O6S/c1-42(39,40)34-23-10-4-5-11-24(23)35-27(21-14-13-17(30)15-22(21)31)26(19-8-2-3-9-20(19)29(35)38)28(37)33-41-16-18-7-6-12-25(36)32-18/h2-3,6-9,12-15,23-24,26-27,34H,4-5,10-11,16H2,1H3,(H,32,36)(H,33,37)/t23-,24-,26+,27-/m0/s1 |
| InChIKey | NGOAPXHOTPHHHO-ATJLQDCWSA-N |
| XLogP | 4.07 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|