C27H35Cl2N5O5S — CID 130193388
(3R,4R)-N-[3-amino-4-(hydroxyamino)butan-2-yl]-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 130193388) has the molecular formula C27H35Cl2N5O5S and a molecular weight of 612.58 g/mol. Its IUPAC name is (3R,4R)-N-[3-amino-4-(hydroxyamino)butan-2-yl]-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-N-[3-amino-4-(hydroxyamino)butan-2-yl]-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 130193388 |
| Molecular Formula | C27H35Cl2N5O5S |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | (3R,4R)-N-[3-amino-4-(hydroxyamino)butan-2-yl]-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CC(NC(=O)[C@@H]1c2ccccc2C(=O)N([C@H]2CCCC[C@@H]2NS(C)(=O)=O)[C@H]1c1ccc(Cl)cc1Cl)C(N)CNO |
| InChI | InChI=1S/C27H35Cl2N5O5S/c1-15(21(30)14-31-37)32-26(35)24-17-7-3-4-8-18(17)27(36)34(25(24)19-12-11-16(28)13-20(19)29)23-10-6-5-9-22(23)33-40(2,38)39/h3-4,7-8,11-13,15,21-25,31,33,37H,5-6,9-10,14,30H2,1-2H3,(H,32,35)/t15?,21?,22-,23-,24+,25-/m0/s1 |
| InChIKey | WJQPDKWYQWFQOP-OXMQAOGHSA-N |
| XLogP | 2.95 |
| TPSA | 153.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|