C32H33Cl2N7O4S — CID 59478834
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-[1-[4-(2H-tetrazol-5-yl)phenyl]ethyl]-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478834) has the molecular formula C32H33Cl2N7O4S and a molecular weight of 682.63 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-[1-[4-(2H-tetrazol-5-yl)phenyl]ethyl]-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-[1-[4-(2H-tetrazol-5-yl)phenyl]ethyl]-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478834 |
| Molecular Formula | C32H33Cl2N7O4S |
| Molecular Weight | 682.63 g/mol |
| Exact Mass | 681.17 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-[1-[4-(2H-tetrazol-5-yl)phenyl]ethyl]-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CC(NC(=O)[C@@H]1c2ccccc2C(=O)N([C@H]2CCCC[C@@H]2NS(C)(=O)=O)[C@H]1c1ccc(Cl)cc1Cl)c1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H33Cl2N7O4S/c1-18(19-11-13-20(14-12-19)30-36-39-40-37-30)35-31(42)28-22-7-3-4-8-23(22)32(43)41(29(28)24-16-15-21(33)17-25(24)34)27-10-6-5-9-26(27)38-46(2,44)45/h3-4,7-8,11-18,26-29,38H,5-6,9-10H2,1-2H3,(H,35,42)(H,36,37,39,40)/t18?,26-,27-,28+,29-/m0/s1 |
| InChIKey | RHYAJJIHVHFTLU-OOGZWPPSSA-N |
| XLogP | 5.19 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |