C32H32Cl2N2O5 — CID 59478341
ethyl 2-[3-(2,4-dichlorophenyl)-1-oxo-4-(phenylmethoxycarbamoyl)-3,4-dihydroisoquinolin-2-yl]cyclohexane-1-carboxylate (PubChem CID 59478341) has the molecular formula C32H32Cl2N2O5 and a molecular weight of 595.52 g/mol. Its IUPAC name is ethyl 2-[3-(2,4-dichlorophenyl)-1-oxo-4-(phenylmethoxycarbamoyl)-3,4-dihydroisoquinolin-2-yl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 2-[3-(2,4-dichlorophenyl)-1-oxo-4-(phenylmethoxycarbamoyl)-3,4-dihydroisoquinolin-2-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59478341 |
| Molecular Formula | C32H32Cl2N2O5 |
| Molecular Weight | 595.52 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | ethyl 2-[3-(2,4-dichlorophenyl)-1-oxo-4-(phenylmethoxycarbamoyl)-3,4-dihydroisoquinolin-2-yl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCCCC1N1C(=O)c2ccccc2C(C(=O)NOCc2ccccc2)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H32Cl2N2O5/c1-2-40-32(39)25-14-8-9-15-27(25)36-29(24-17-16-21(33)18-26(24)34)28(22-12-6-7-13-23(22)31(36)38)30(37)35-41-19-20-10-4-3-5-11-20/h3-7,10-13,16-18,25,27-29H,2,8-9,14-15,19H2,1H3,(H,35,37) |
| InChIKey | DHIVEFKHCWAQTB-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.52 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|