C32H35Cl2N3O8S — CID 162108602
2-[4-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfinamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]phenoxy]acetic acid;hydrate (PubChem CID 162108602) has the molecular formula C32H35Cl2N3O8S and a molecular weight of 692.62 g/mol. Its IUPAC name is 2-[4-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfinamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]phenoxy]acetic acid;hydrate.
| Compound Name | 2-[4-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfinamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]phenoxy]acetic acid;hydrate |
|---|---|
| PubChem CID | 162108602 |
| Molecular Formula | C32H35Cl2N3O8S |
| Molecular Weight | 692.62 g/mol |
| Exact Mass | 691.15 |
| IUPAC Name | 2-[4-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfinamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]phenoxy]acetic acid;hydrate |
| SMILES | CS(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2ccc(OCC(=O)O)cc2)[C@@H]1c1ccc(Cl)cc1Cl.O |
| InChI | InChI=1S/C32H33Cl2N3O7S.H2O/c1-45(42)36-26-8-4-5-9-27(26)37-30(24-15-12-20(33)16-25(24)34)29(22-6-2-3-7-23(22)32(37)41)31(40)35-44-17-19-10-13-21(14-11-19)43-18-28(38)39;/h2-3,6-7,10-16,26-27,29-30,36H,4-5,8-9,17-18H2,1H3,(H,35,40)(H,38,39);1H2/t26-,27-,29+,30-,45?;/m0./s1 |
| InChIKey | XKTDZRKZXIGHGB-FTLDKNOESA-N |
| XLogP | 4.36 |
| TPSA | 165.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|