C33H35Cl2N3O8S — CID 118358341
2-[3-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[methyl(methylsulfonyl)amino]cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]phenoxy]acetic acid (PubChem CID 118358341) has the molecular formula C33H35Cl2N3O8S and a molecular weight of 704.63 g/mol. Its IUPAC name is 2-[3-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[methyl(methylsulfonyl)amino]cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[methyl(methylsulfonyl)amino]cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 118358341 |
| Molecular Formula | C33H35Cl2N3O8S |
| Molecular Weight | 704.63 g/mol |
| Exact Mass | 703.15 |
| IUPAC Name | 2-[3-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[methyl(methylsulfonyl)amino]cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]phenoxy]acetic acid |
| SMILES | CN([C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2cccc(OCC(=O)O)c2)[C@@H]1c1ccc(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C33H35Cl2N3O8S/c1-37(47(2,43)44)27-12-5-6-13-28(27)38-31(25-15-14-21(34)17-26(25)35)30(23-10-3-4-11-24(23)33(38)42)32(41)36-46-18-20-8-7-9-22(16-20)45-19-29(39)40/h3-4,7-11,14-17,27-28,30-31H,5-6,12-13,18-19H2,1-2H3,(H,36,41)(H,39,40)/t27-,28-,30+,31-/m0/s1 |
| InChIKey | WMANKPNYWOSHPF-ZFFOCMCDSA-N |
| XLogP | 5.19 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|