C33H36Cl2N4O7S — CID 59479041
ethyl 2-[[(1S,2S)-2-[(3R,4R)-3-(2,4-dichlorophenyl)-1-oxo-4-(pyridin-2-ylmethoxycarbamoyl)-3,4-dihydroisoquinolin-2-yl]cyclohexyl]-methylsulfonylamino]acetate (PubChem CID 59479041) has the molecular formula C33H36Cl2N4O7S and a molecular weight of 703.65 g/mol. Its IUPAC name is ethyl 2-[[(1S,2S)-2-[(3R,4R)-3-(2,4-dichlorophenyl)-1-oxo-4-(pyridin-2-ylmethoxycarbamoyl)-3,4-dihydroisoquinolin-2-yl]cyclohexyl]-methylsulfonylamino]acetate.
| Compound Name | ethyl 2-[[(1S,2S)-2-[(3R,4R)-3-(2,4-dichlorophenyl)-1-oxo-4-(pyridin-2-ylmethoxycarbamoyl)-3,4-dihydroisoquinolin-2-yl]cyclohexyl]-methylsulfonylamino]acetate |
|---|---|
| PubChem CID | 59479041 |
| Molecular Formula | C33H36Cl2N4O7S |
| Molecular Weight | 703.65 g/mol |
| Exact Mass | 702.17 |
| IUPAC Name | ethyl 2-[[(1S,2S)-2-[(3R,4R)-3-(2,4-dichlorophenyl)-1-oxo-4-(pyridin-2-ylmethoxycarbamoyl)-3,4-dihydroisoquinolin-2-yl]cyclohexyl]-methylsulfonylamino]acetate |
| SMILES | CCOC(=O)CN([C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2ccccn2)[C@@H]1c1ccc(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C33H36Cl2N4O7S/c1-3-45-29(40)19-38(47(2,43)44)27-13-6-7-14-28(27)39-31(25-16-15-21(34)18-26(25)35)30(23-11-4-5-12-24(23)33(39)42)32(41)37-46-20-22-10-8-9-17-36-22/h4-5,8-12,15-18,27-28,30-31H,3,6-7,13-14,19-20H2,1-2H3,(H,37,41)/t27-,28-,30+,31-/m0/s1 |
| InChIKey | PSTFAKHYZSRERX-ZFFOCMCDSA-N |
| XLogP | 5.05 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|