C30H30Cl2N4O5 — CID 59478851
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[(2-hydroxyacetyl)amino]cyclohexyl]-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478851) has the molecular formula C30H30Cl2N4O5 and a molecular weight of 597.50 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[(2-hydroxyacetyl)amino]cyclohexyl]-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[(2-hydroxyacetyl)amino]cyclohexyl]-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478851 |
| Molecular Formula | C30H30Cl2N4O5 |
| Molecular Weight | 597.50 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[(2-hydroxyacetyl)amino]cyclohexyl]-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | O=C(CO)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2ccccn2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H30Cl2N4O5/c31-18-12-13-22(23(32)15-18)28-27(29(39)35-41-17-19-7-5-6-14-33-19)20-8-1-2-9-21(20)30(40)36(28)25-11-4-3-10-24(25)34-26(38)16-37/h1-2,5-9,12-15,24-25,27-28,37H,3-4,10-11,16-17H2,(H,34,38)(H,35,39)/t24-,25-,27+,28-/m0/s1 |
| InChIKey | WPNGTDDIBJARMS-KWNVVKLJSA-N |
| XLogP | 4.34 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|