C29H29ClN4O4 — CID 89098271
2-(2-carbamoylcyclohexyl)-3-(4-chlorophenyl)-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 89098271) has the molecular formula C29H29ClN4O4 and a molecular weight of 533.03 g/mol. Its IUPAC name is 2-(2-carbamoylcyclohexyl)-3-(4-chlorophenyl)-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | 2-(2-carbamoylcyclohexyl)-3-(4-chlorophenyl)-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 89098271 |
| Molecular Formula | C29H29ClN4O4 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 2-(2-carbamoylcyclohexyl)-3-(4-chlorophenyl)-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | NC(=O)C1CCCCC1N1C(=O)c2ccccc2C(C(=O)NOCc2ccccn2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H29ClN4O4/c30-19-14-12-18(13-15-19)26-25(28(36)33-38-17-20-7-5-6-16-32-20)21-8-1-2-9-22(21)29(37)34(26)24-11-4-3-10-23(24)27(31)35/h1-2,5-9,12-16,23-26H,3-4,10-11,17H2,(H2,31,35)(H,33,36) |
| InChIKey | BWGXXCFMIZXNSC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|