C27H27Cl2N5O4 — CID 137390280
(3R,4R)-2-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-N-[(5-hydroxypyrimidin-2-yl)methoxy]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 137390280) has the molecular formula C27H27Cl2N5O4 and a molecular weight of 556.45 g/mol. Its IUPAC name is (3R,4R)-2-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-N-[(5-hydroxypyrimidin-2-yl)methoxy]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-2-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-N-[(5-hydroxypyrimidin-2-yl)methoxy]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 137390280 |
| Molecular Formula | C27H27Cl2N5O4 |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | (3R,4R)-2-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-N-[(5-hydroxypyrimidin-2-yl)methoxy]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2ncc(O)cn2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H27Cl2N5O4/c28-15-9-10-19(20(29)11-15)25-24(26(36)33-38-14-23-31-12-16(35)13-32-23)17-5-1-2-6-18(17)27(37)34(25)22-8-4-3-7-21(22)30/h1-2,5-6,9-13,21-22,24-25,35H,3-4,7-8,14,30H2,(H,33,36)/t21-,22-,24+,25-/m0/s1 |
| InChIKey | YOLVEANBSCRSCE-HFOXQMJASA-N |
| XLogP | 4.29 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|