C31H31Cl2FN3O7S- — CID 162255350
3-[[[(3R,4R)-2-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-4-fluorobenzoic acid;methanesulfinate (PubChem CID 162255350) has the molecular formula C31H31Cl2FN3O7S- and a molecular weight of 679.57 g/mol. Its IUPAC name is 3-[[[(3R,4R)-2-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-4-fluorobenzoic acid;methanesulfinate.
| Compound Name | 3-[[[(3R,4R)-2-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-4-fluorobenzoic acid;methanesulfinate |
|---|---|
| PubChem CID | 162255350 |
| Molecular Formula | C31H31Cl2FN3O7S- |
| Molecular Weight | 679.57 g/mol |
| Exact Mass | 678.12 |
| IUPAC Name | 3-[[[(3R,4R)-2-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-4-fluorobenzoic acid;methanesulfinate |
| SMILES | CS(=O)[O-].N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2cc(C(=O)O)ccc2F)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H28Cl2FN3O5.CH4O2S/c31-18-10-11-21(22(32)14-18)27-26(28(37)35-41-15-17-13-16(30(39)40)9-12-23(17)33)19-5-1-2-6-20(19)29(38)36(27)25-8-4-3-7-24(25)34;1-4(2)3/h1-2,5-6,9-14,24-27H,3-4,7-8,15,34H2,(H,35,37)(H,39,40);1H3,(H,2,3)/p-1/t24-,25-,26+,27-;/m0./s1 |
| InChIKey | MKWPULLFQNEXDP-VXAYZFSMSA-M |
| XLogP | 5.12 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|