C30H27Cl2FN4O5 — CID 118358318
3-[[[(3R,4R)-2-[(1S,2S)-2-diazenylcyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-5-fluorobenzoic acid (PubChem CID 118358318) has the molecular formula C30H27Cl2FN4O5 and a molecular weight of 613.47 g/mol. Its IUPAC name is 3-[[[(3R,4R)-2-[(1S,2S)-2-diazenylcyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-5-fluorobenzoic acid.
| Compound Name | 3-[[[(3R,4R)-2-[(1S,2S)-2-diazenylcyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 118358318 |
| Molecular Formula | C30H27Cl2FN4O5 |
| Molecular Weight | 613.47 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 3-[[[(3R,4R)-2-[(1S,2S)-2-diazenylcyclohexyl]-3-(2,4-dichlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]-5-fluorobenzoic acid |
| SMILES | [H]/N=N/[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2cc(F)cc(C(=O)O)c2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H27Cl2FN4O5/c31-18-9-10-22(23(32)14-18)27-26(28(38)36-42-15-16-11-17(30(40)41)13-19(33)12-16)20-5-1-2-6-21(20)29(39)37(27)25-8-4-3-7-24(25)35-34/h1-2,5-6,9-14,24-27,34H,3-4,7-8,15H2,(H,36,38)(H,40,41)/b35-34+/t24-,25-,26+,27-/m0/s1 |
| InChIKey | OWOLTSBANPIPDJ-GFSIGFORSA-N |
| XLogP | 6.70 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.47 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|