C32H33Cl2N3O7S — CID 59478944
3-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[methyl(methylsulfonyl)amino]cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]benzoic acid (PubChem CID 59478944) has the molecular formula C32H33Cl2N3O7S and a molecular weight of 674.60 g/mol. Its IUPAC name is 3-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[methyl(methylsulfonyl)amino]cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]benzoic acid.
| Compound Name | 3-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[methyl(methylsulfonyl)amino]cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 59478944 |
| Molecular Formula | C32H33Cl2N3O7S |
| Molecular Weight | 674.60 g/mol |
| Exact Mass | 673.14 |
| IUPAC Name | 3-[[[(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[methyl(methylsulfonyl)amino]cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]benzoic acid |
| SMILES | CN([C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2cccc(C(=O)O)c2)[C@@H]1c1ccc(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C32H33Cl2N3O7S/c1-36(45(2,42)43)26-12-5-6-13-27(26)37-29(24-15-14-21(33)17-25(24)34)28(22-10-3-4-11-23(22)31(37)39)30(38)35-44-18-19-8-7-9-20(16-19)32(40)41/h3-4,7-11,14-17,26-29H,5-6,12-13,18H2,1-2H3,(H,35,38)(H,40,41)/t26-,27-,28+,29-/m0/s1 |
| InChIKey | SYWKLXGTJGTLBC-FKWFRFQNSA-N |
| XLogP | 5.42 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|