C26H28Cl2N4O5S — CID 59478798
(3R,4R)-N-(cyanomethoxy)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[methyl(methylsulfonyl)amino]cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478798) has the molecular formula C26H28Cl2N4O5S and a molecular weight of 579.51 g/mol. Its IUPAC name is (3R,4R)-N-(cyanomethoxy)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[methyl(methylsulfonyl)amino]cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-N-(cyanomethoxy)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[methyl(methylsulfonyl)amino]cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478798 |
| Molecular Formula | C26H28Cl2N4O5S |
| Molecular Weight | 579.51 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | (3R,4R)-N-(cyanomethoxy)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-[methyl(methylsulfonyl)amino]cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CN([C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCC#N)[C@@H]1c1ccc(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C26H28Cl2N4O5S/c1-31(38(2,35)36)21-9-5-6-10-22(21)32-24(19-12-11-16(27)15-20(19)28)23(25(33)30-37-14-13-29)17-7-3-4-8-18(17)26(32)34/h3-4,7-8,11-12,15,21-24H,5-6,9-10,14H2,1-2H3,(H,30,33)/t21-,22-,23+,24-/m0/s1 |
| InChIKey | JTTUOCNVIUEAKE-XQUALCHDSA-N |
| XLogP | 4.05 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|