C32H32ClN3O6 — CID 89030006
3-[[[(3R,4R)-2-[(1S,2S)-2-acetamidocyclohexyl]-3-(4-chlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]benzoic acid (PubChem CID 89030006) has the molecular formula C32H32ClN3O6 and a molecular weight of 590.08 g/mol. Its IUPAC name is 3-[[[(3R,4R)-2-[(1S,2S)-2-acetamidocyclohexyl]-3-(4-chlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]benzoic acid.
| Compound Name | 3-[[[(3R,4R)-2-[(1S,2S)-2-acetamidocyclohexyl]-3-(4-chlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 89030006 |
| Molecular Formula | C32H32ClN3O6 |
| Molecular Weight | 590.08 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | 3-[[[(3R,4R)-2-[(1S,2S)-2-acetamidocyclohexyl]-3-(4-chlorophenyl)-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]benzoic acid |
| SMILES | CC(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](C(=O)NOCc2cccc(C(=O)O)c2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H32ClN3O6/c1-19(37)34-26-11-4-5-12-27(26)36-29(21-13-15-23(33)16-14-21)28(24-9-2-3-10-25(24)31(36)39)30(38)35-42-18-20-7-6-8-22(17-20)32(40)41/h2-3,6-10,13-17,26-29H,4-5,11-12,18H2,1H3,(H,34,37)(H,35,38)(H,40,41)/t26-,27-,28+,29-/m0/s1 |
| InChIKey | RSEXDOGPXRKSSP-FKWFRFQNSA-N |
| XLogP | 5.01 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.08 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|