C30H32N2O4 — CID 89030190
2-(2-hydroxycyclohexyl)-3-(4-methylphenyl)-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 89030190) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-(2-hydroxycyclohexyl)-3-(4-methylphenyl)-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | 2-(2-hydroxycyclohexyl)-3-(4-methylphenyl)-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 89030190 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 2-(2-hydroxycyclohexyl)-3-(4-methylphenyl)-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | Cc1ccc(C2C(C(=O)NOCc3ccccc3)c3ccccc3C(=O)N2C2CCCCC2O)cc1 |
| InChI | InChI=1S/C30H32N2O4/c1-20-15-17-22(18-16-20)28-27(29(34)31-36-19-21-9-3-2-4-10-21)23-11-5-6-12-24(23)30(35)32(28)25-13-7-8-14-26(25)33/h2-6,9-12,15-18,25-28,33H,7-8,13-14,19H2,1H3,(H,31,34) |
| InChIKey | XYGHWVPPPGJFGN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|