C32H35Cl2N3O6S — CID 137389943
2-[4-[[[(3R,4S)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfinamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinolin-4-yl]methylamino]oxymethyl]phenoxy]acetic acid (PubChem CID 137389943) has the molecular formula C32H35Cl2N3O6S and a molecular weight of 660.62 g/mol. Its IUPAC name is 2-[4-[[[(3R,4S)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfinamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinolin-4-yl]methylamino]oxymethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[[(3R,4S)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfinamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinolin-4-yl]methylamino]oxymethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 137389943 |
| Molecular Formula | C32H35Cl2N3O6S |
| Molecular Weight | 660.62 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | 2-[4-[[[(3R,4S)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfinamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinolin-4-yl]methylamino]oxymethyl]phenoxy]acetic acid |
| SMILES | CS(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccccc2[C@@H](CNOCc2ccc(OCC(=O)O)cc2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H35Cl2N3O6S/c1-44(41)36-28-8-4-5-9-29(28)37-31(25-15-12-21(33)16-27(25)34)26(23-6-2-3-7-24(23)32(37)40)17-35-43-18-20-10-13-22(14-11-20)42-19-30(38)39/h2-3,6-7,10-16,26,28-29,31,35-36H,4-5,8-9,17-19H2,1H3,(H,38,39)/t26-,28+,29+,31+,44?/m1/s1 |
| InChIKey | CZEZXYRZYURJNQ-ZMHYGEBJSA-N |
| XLogP | 5.65 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|