C32H37N3O7S — CID 59479102
(3R,4R)-3-(2,4-dimethoxyphenyl)-2-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59479102) has the molecular formula C32H37N3O7S and a molecular weight of 607.73 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dimethoxyphenyl)-2-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dimethoxyphenyl)-2-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59479102 |
| Molecular Formula | C32H37N3O7S |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | (3R,4R)-3-(2,4-dimethoxyphenyl)-2-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]-1-oxo-N-phenylmethoxy-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | COc1ccc([C@H]2[C@H](C(=O)NOCc3ccccc3)c3ccccc3C(=O)N2[C@@H]2CCCC[C@H]2NS(C)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C32H37N3O7S/c1-40-22-17-18-25(28(19-22)41-2)30-29(31(36)33-42-20-21-11-5-4-6-12-21)23-13-7-8-14-24(23)32(37)35(30)27-16-10-9-15-26(27)34-43(3,38)39/h4-8,11-14,17-19,26-27,29-30,34H,9-10,15-16,20H2,1-3H3,(H,33,36)/t26-,27-,29-,30+/m1/s1 |
| InChIKey | AWFBNKMYAOLQKW-OQGMSKNBSA-N |
| XLogP | 4.09 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|