C30H32N2O6 — CID 140666851
benzyl (10R,15S)-4-methoxy-10,16-dimethyl-12,17-dioxo-8-oxa-11,16-diazatricyclo[16.3.1.02,7]docosa-1(22),2(7),3,5,18,20-hexaene-15-carboxylate (PubChem CID 140666851) has the molecular formula C30H32N2O6 and a molecular weight of 516.59 g/mol. Its IUPAC name is benzyl (10R,15S)-4-methoxy-10,16-dimethyl-12,17-dioxo-8-oxa-11,16-diazatricyclo[16.3.1.02,7]docosa-1(22),2(7),3,5,18,20-hexaene-15-carboxylate.
| Compound Name | benzyl (10R,15S)-4-methoxy-10,16-dimethyl-12,17-dioxo-8-oxa-11,16-diazatricyclo[16.3.1.02,7]docosa-1(22),2(7),3,5,18,20-hexaene-15-carboxylate |
|---|---|
| PubChem CID | 140666851 |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | benzyl (10R,15S)-4-methoxy-10,16-dimethyl-12,17-dioxo-8-oxa-11,16-diazatricyclo[16.3.1.02,7]docosa-1(22),2(7),3,5,18,20-hexaene-15-carboxylate |
| SMILES | COc1ccc2c(c1)-c1cccc(c1)C(=O)N(C)[C@H](C(=O)OCc1ccccc1)CCC(=O)N[C@H](C)CO2 |
| InChI | InChI=1S/C30H32N2O6/c1-20-18-37-27-14-12-24(36-3)17-25(27)22-10-7-11-23(16-22)29(34)32(2)26(13-15-28(33)31-20)30(35)38-19-21-8-5-4-6-9-21/h4-12,14,16-17,20,26H,13,15,18-19H2,1-3H3,(H,31,33)/t20-,26+/m1/s1 |
| InChIKey | UMDUNTGBQMQQCW-IBVKSMDESA-N |
| XLogP | 4.22 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |