C14H17NO3 — CID 70113338
benzyl (2S,3R)-3-ethyl-5-oxopyrrolidine-2-carboxylate (PubChem CID 70113338) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is benzyl (2S,3R)-3-ethyl-5-oxopyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S,3R)-3-ethyl-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70113338 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | benzyl (2S,3R)-3-ethyl-5-oxopyrrolidine-2-carboxylate |
| SMILES | CC[C@@H]1CC(=O)N[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H17NO3/c1-2-11-8-12(16)15-13(11)14(17)18-9-10-6-4-3-5-7-10/h3-7,11,13H,2,8-9H2,1H3,(H,15,16)/t11-,13+/m1/s1 |
| InChIKey | JOAGEZUMKWKNBT-YPMHNXCESA-N |
| XLogP | 1.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |