C31H20FNO3 — CID 141397588
1-[(4-fluorophenyl)methoxy]-3,4-dinaphthalen-2-ylpyrrole-2,5-dione (PubChem CID 141397588) has the molecular formula C31H20FNO3 and a molecular weight of 473.50 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methoxy]-3,4-dinaphthalen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-[(4-fluorophenyl)methoxy]-3,4-dinaphthalen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 141397588 |
| Molecular Formula | C31H20FNO3 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methoxy]-3,4-dinaphthalen-2-ylpyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc3ccccc3c2)=C(c2ccc3ccccc3c2)C(=O)N1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C31H20FNO3/c32-27-15-9-20(10-16-27)19-36-33-30(34)28(25-13-11-21-5-1-3-7-23(21)17-25)29(31(33)35)26-14-12-22-6-2-4-8-24(22)18-26/h1-18H,19H2 |
| InChIKey | BALOODFDTRYWDQ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|