C26H24O4 — CID 59354781
4-(4-methoxyphenyl)-2,2-dimethyl-5-(4-phenylmethoxyphenyl)furan-3-one (PubChem CID 59354781) has the molecular formula C26H24O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,2-dimethyl-5-(4-phenylmethoxyphenyl)furan-3-one.
| Compound Name | 4-(4-methoxyphenyl)-2,2-dimethyl-5-(4-phenylmethoxyphenyl)furan-3-one |
|---|---|
| PubChem CID | 59354781 |
| Molecular Formula | C26H24O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,2-dimethyl-5-(4-phenylmethoxyphenyl)furan-3-one |
| SMILES | COc1ccc(C2=C(c3ccc(OCc4ccccc4)cc3)OC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C26H24O4/c1-26(2)25(27)23(19-9-13-21(28-3)14-10-19)24(30-26)20-11-15-22(16-12-20)29-17-18-7-5-4-6-8-18/h4-16H,17H2,1-3H3 |
| InChIKey | XFYWNTGVBYCVKK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|