C29H22N2O3 — CID 59354772
5-(4-isocyanophenyl)-2,2-dimethyl-4-[4-(quinolin-2-ylmethoxy)phenyl]furan-3-one (PubChem CID 59354772) has the molecular formula C29H22N2O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is 5-(4-isocyanophenyl)-2,2-dimethyl-4-[4-(quinolin-2-ylmethoxy)phenyl]furan-3-one.
| Compound Name | 5-(4-isocyanophenyl)-2,2-dimethyl-4-[4-(quinolin-2-ylmethoxy)phenyl]furan-3-one |
|---|---|
| PubChem CID | 59354772 |
| Molecular Formula | C29H22N2O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 5-(4-isocyanophenyl)-2,2-dimethyl-4-[4-(quinolin-2-ylmethoxy)phenyl]furan-3-one |
| SMILES | [C-]#[N+]c1ccc(C2=C(c3ccc(OCc4ccc5ccccc5n4)cc3)C(=O)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C29H22N2O3/c1-29(2)28(32)26(27(34-29)21-9-13-22(30-3)14-10-21)20-11-16-24(17-12-20)33-18-23-15-8-19-6-4-5-7-25(19)31-23/h4-17H,18H2,1-2H3 |
| InChIKey | YEFXWDMMDWRVAN-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 52.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|