C32H30N2O5 — CID 130413037
N-acetyl-N-[4-[3-hydroxy-2,2-dimethyl-4-[4-(quinolin-2-ylmethoxy)phenyl]-3H-furan-5-yl]phenyl]acetamide (PubChem CID 130413037) has the molecular formula C32H30N2O5 and a molecular weight of 522.60 g/mol. Its IUPAC name is N-acetyl-N-[4-[3-hydroxy-2,2-dimethyl-4-[4-(quinolin-2-ylmethoxy)phenyl]-3H-furan-5-yl]phenyl]acetamide.
| Compound Name | N-acetyl-N-[4-[3-hydroxy-2,2-dimethyl-4-[4-(quinolin-2-ylmethoxy)phenyl]-3H-furan-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 130413037 |
| Molecular Formula | C32H30N2O5 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | N-acetyl-N-[4-[3-hydroxy-2,2-dimethyl-4-[4-(quinolin-2-ylmethoxy)phenyl]-3H-furan-5-yl]phenyl]acetamide |
| SMILES | CC(=O)N(C(C)=O)c1ccc(C2=C(c3ccc(OCc4ccc5ccccc5n4)cc3)C(O)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C32H30N2O5/c1-20(35)34(21(2)36)26-15-10-24(11-16-26)30-29(31(37)32(3,4)39-30)23-12-17-27(18-13-23)38-19-25-14-9-22-7-5-6-8-28(22)33-25/h5-18,31,37H,19H2,1-4H3 |
| InChIKey | LBJHAJMGKICXBF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|