C29H23F2NO4 — CID 130404190
5-[4-(difluoromethoxy)phenyl]-2,2-dimethyl-4-[4-(quinolin-2-ylmethoxy)phenyl]furan-3-one (PubChem CID 130404190) has the molecular formula C29H23F2NO4 and a molecular weight of 487.50 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-2,2-dimethyl-4-[4-(quinolin-2-ylmethoxy)phenyl]furan-3-one.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-2,2-dimethyl-4-[4-(quinolin-2-ylmethoxy)phenyl]furan-3-one |
|---|---|
| PubChem CID | 130404190 |
| Molecular Formula | C29H23F2NO4 |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-2,2-dimethyl-4-[4-(quinolin-2-ylmethoxy)phenyl]furan-3-one |
| SMILES | CC1(C)OC(c2ccc(OC(F)F)cc2)=C(c2ccc(OCc3ccc4ccccc4n3)cc2)C1=O |
| InChI | InChI=1S/C29H23F2NO4/c1-29(2)27(33)25(26(36-29)20-10-15-23(16-11-20)35-28(30)31)19-8-13-22(14-9-19)34-17-21-12-7-18-5-3-4-6-24(18)32-21/h3-16,28H,17H2,1-2H3 |
| InChIKey | BGHOBKRNCRXKEH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|