C39H30N2O4S — CID 54498931
2-[3,4-bis[4-(quinolin-2-ylmethoxy)phenyl]furan-2-yl]propanethioic S-acid (PubChem CID 54498931) has the molecular formula C39H30N2O4S and a molecular weight of 622.75 g/mol. Its IUPAC name is 2-[3,4-bis[4-(quinolin-2-ylmethoxy)phenyl]furan-2-yl]propanethioic S-acid.
| Compound Name | 2-[3,4-bis[4-(quinolin-2-ylmethoxy)phenyl]furan-2-yl]propanethioic S-acid |
|---|---|
| PubChem CID | 54498931 |
| Molecular Formula | C39H30N2O4S |
| Molecular Weight | 622.75 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | 2-[3,4-bis[4-(quinolin-2-ylmethoxy)phenyl]furan-2-yl]propanethioic S-acid |
| SMILES | CC(C(=O)S)c1occ(-c2ccc(OCc3ccc4ccccc4n3)cc2)c1-c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C39H30N2O4S/c1-25(39(42)46)38-37(29-14-20-33(21-15-29)44-23-31-17-11-28-7-3-5-9-36(28)41-31)34(24-45-38)26-12-18-32(19-13-26)43-22-30-16-10-27-6-2-4-8-35(27)40-30/h2-21,24-25H,22-23H2,1H3,(H,42,46) |
| InChIKey | YBBNNXDPWSUJEH-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 74.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.75 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|